Products 1527524-87-3
CAS 1527524-87-3 is the registry number for 6-Chloro-1-(6-fluoropyridin-2-yl)-1H-pyrazolo(4,3-c)pyridine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-1-(6-fluoro-2-pyridinyl)pyrazolo[4,3-c]pyridine (CAS 1527524-87-3) is a chemical compound with the molecular formula C11H6ClFN4 and a molecular weight of 248.64 g/mol. IUPAC name: 6-chloro-1-(6-fluoro-2-pyridinyl)pyrazolo[4,3-c]pyridine. InChIKey: MLPYVNPNOBYVSV-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFN4 |
|---|---|
| Molecular weight | 248.64 g/mol |
| IUPAC name | 6-chloro-1-(6-fluoro-2-pyridinyl)pyrazolo[4,3-c]pyridine |
| InChIKey | MLPYVNPNOBYVSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)F)N2C3=CC(=NC=C3C=N2)Cl |
Computed by PubChem (NCBI)