CAS 1956376-33-2 is the registry number for 7-Chloro-2-(4-fluorophenyl)-2h-pyrazolo[3,4-d]pyridazine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-chloro-2-(4-fluorophenyl)pyrazolo[3,4-d]pyridazine (CAS 1956376-33-2) is a chemical compound with the molecular formula C11H6ClFN4 and a molecular weight of 248.64 g/mol. IUPAC name: 7-chloro-2-(4-fluorophenyl)pyrazolo[3,4-d]pyridazine. InChIKey: SKMUEZSUSWKYPH-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFN4 |
|---|---|
| Molecular weight | 248.64 g/mol |
| IUPAC name | 7-chloro-2-(4-fluorophenyl)pyrazolo[3,4-d]pyridazine |
| InChIKey | SKMUEZSUSWKYPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C3C=NN=C(C3=N2)Cl)F |
Computed by PubChem (NCBI)