CAS 1116743-29-3 is the registry number for 3-Chloro-6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1116743-29-3) is a chemical compound with the molecular formula C11H6ClFN4 and a molecular weight of 248.64 g/mol. IUPAC name: 3-chloro-6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: UFYSEIRQWVNZCO-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFN4 |
|---|---|
| Molecular weight | 248.64 g/mol |
| IUPAC name | 3-chloro-6-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | UFYSEIRQWVNZCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN3C(=NN=C3Cl)C=C2)F |
Computed by PubChem (NCBI)