CAS 885524-07-2 appears in our catalog under these names: 4-Chloro-1-(4-fluorophenyl)-1H-pyrazolo(3,4-d)pyrimidine, 97%, 4-Chloro-1-(4-fluorophenyl)-1H-pyrazolo(3,4-d)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g.
4-chloro-1-(4-fluorophenyl)pyrazolo[5,4-d]pyrimidine (CAS 885524-07-2) is a chemical compound with the molecular formula C11H6ClFN4 and a molecular weight of 248.64 g/mol. IUPAC name: 4-chloro-1-(4-fluorophenyl)pyrazolo[5,4-d]pyrimidine. InChIKey: GBKPQRDTVISISD-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFN4 |
|---|---|
| Molecular weight | 248.64 g/mol |
| IUPAC name | 4-chloro-1-(4-fluorophenyl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | GBKPQRDTVISISD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C3=C(C=N2)C(=NC=N3)Cl)F |
Computed by PubChem (NCBI)