CAS 1094374-86-3 is the registry number for 3-(3,4-Difluorobenzoyl)pyridine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(3,4-difluorophenyl)-pyridin-3-ylmethanone (CAS 1094374-86-3) is a chemical compound with the molecular formula C12H7F2NO and a molecular weight of 219.19 g/mol. IUPAC name: (3,4-difluorophenyl)-pyridin-3-ylmethanone. InChIKey: RZEXCZJJQFDSMN-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | (3,4-difluorophenyl)-pyridin-3-ylmethanone |
| InChIKey | RZEXCZJJQFDSMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)