Products 1206969-49-4
CAS 1206969-49-4 is the registry number for 2-Fluoro-5-(6-fluoropyridin-3-yl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-fluoro-5-(6-fluoro-3-pyridinyl)benzaldehyde (CAS 1206969-49-4) is a chemical compound with the molecular formula C12H7F2NO and a molecular weight of 219.19 g/mol. IUPAC name: 2-fluoro-5-(6-fluoro-3-pyridinyl)benzaldehyde. InChIKey: BJMJZEFCAYFGRH-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 2-fluoro-5-(6-fluoro-3-pyridinyl)benzaldehyde |
| InChIKey | BJMJZEFCAYFGRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CN=C(C=C2)F)C=O)F |
Computed by PubChem (NCBI)