CAS 1158955-21-5 appears in our catalog under these names: (2,6–Difluoropyridin–3–yl)(phenyl)methanone, (2,6-Difluoropyridin-3-yl)(phenyl)methanone 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g.
(2,6-difluoro-3-pyridinyl)-phenylmethanone (CAS 1158955-21-5) is a chemical compound with the molecular formula C12H7F2NO and a molecular weight of 219.19 g/mol. IUPAC name: (2,6-difluoro-3-pyridinyl)-phenylmethanone. InChIKey: INYPHEHCTMUQFS-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | (2,6-difluoro-3-pyridinyl)-phenylmethanone |
| InChIKey | INYPHEHCTMUQFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(N=C(C=C2)F)F |
Computed by PubChem (NCBI)