CAS 2138265-63-9 is the registry number for 5-(2,5-Difluorophenyl)pyridine-2-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(2,5-difluorophenyl)pyridine-2-carbaldehyde (CAS 2138265-63-9) is a chemical compound with the molecular formula C12H7F2NO and a molecular weight of 219.19 g/mol. IUPAC name: 5-(2,5-difluorophenyl)pyridine-2-carbaldehyde. InChIKey: BWURXOKFLKZRSF-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 5-(2,5-difluorophenyl)pyridine-2-carbaldehyde |
| InChIKey | BWURXOKFLKZRSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C2=CN=C(C=C2)C=O)F |
Computed by PubChem (NCBI)