CAS 150020-06-7 is the registry number for 4-(2,5-Difluorobenzoyl)pyridine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(2,5-difluorophenyl)-pyridin-4-ylmethanone (CAS 150020-06-7) is a chemical compound with the molecular formula C12H7F2NO and a molecular weight of 219.19 g/mol. IUPAC name: (2,5-difluorophenyl)-pyridin-4-ylmethanone. InChIKey: QCICHYIROXZUQG-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | (2,5-difluorophenyl)-pyridin-4-ylmethanone |
| InChIKey | QCICHYIROXZUQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)C2=CC=NC=C2)F |
Computed by PubChem (NCBI)