CAS 1094377-59-9 appears in our catalog under these names: 1-tert-Butyl-1h,4h,5h-pyrazolo[3,4-d]pyrimidin-4-one, 95%, 1-(tert-Butyl)-1,5-dihydro-4H-pyrazolo(3,4-d)pyrimidin-4-one, 98%, 1-tert-Butyl-5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 2,5g.
1-tert-butyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1094377-59-9) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: 1-tert-butyl-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: ZZRIVNFFUGROHS-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 1-tert-butyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | ZZRIVNFFUGROHS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C=N1)C(=O)NC=N2 |
Computed by PubChem (NCBI)