CAS 1609406-60-1 is the registry number for [3-(5-Methyl-4h-1,2,4-triazol-3-yl)phenyl]amine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline;hydrate (CAS 1609406-60-1) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: 3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline;hydrate. InChIKey: WNNZJFVNICBRSG-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 3-(5-methyl-1H-1,2,4-triazol-3-yl)aniline;hydrate |
| InChIKey | WNNZJFVNICBRSG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)C2=CC(=CC=C2)N.O |
Computed by PubChem (NCBI)