CAS 16825-24-4 is the registry number for N'-[(1E)-(dimethylamino)methylidene]pyridine-4-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[(E)-dimethylaminomethylideneamino]pyridine-4-carboxamide (CAS 16825-24-4) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: N-[(E)-dimethylaminomethylideneamino]pyridine-4-carboxamide. InChIKey: OJYQADLIYHRBEX-YRNVUSSQSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | N-[(E)-dimethylaminomethylideneamino]pyridine-4-carboxamide |
| InChIKey | OJYQADLIYHRBEX-YRNVUSSQSA-N |
| SMILES | CN(C)/C=N/NC(=O)C1=CC=NC=C1 |
Computed by PubChem (NCBI)