CAS 1286279-33-1 appears in our catalog under these names: 7-tert-Butylpyrazolo[1,5-a][1,3,5]triazin-4(3h)-one, 98%, 7-(tert-Butyl)pyrazolo(1,5-a)(1,3,5)triazin-4(3H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
7-tert-butyl-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one (CAS 1286279-33-1) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: 7-tert-butyl-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one. InChIKey: TWIRTOOIBISMKQ-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 7-tert-butyl-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
| InChIKey | TWIRTOOIBISMKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN2C(=C1)N=CNC2=O |
Computed by PubChem (NCBI)