CAS 2140305-49-1 is the registry number for 7-tert-butyl-1H-pyrazolo[1,5-a][1,3,5]triazin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
7-tert-butyl-1H-pyrazolo[1,5-a][1,3,5]triazin-2-one (CAS 2140305-49-1) is a chemical compound with the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. IUPAC name: 7-tert-butyl-1H-pyrazolo[1,5-a][1,3,5]triazin-2-one. InChIKey: SOQLLXQXDBRVQP-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O |
|---|---|
| Molecular weight | 192.22 g/mol |
| IUPAC name | 7-tert-butyl-1H-pyrazolo[1,5-a][1,3,5]triazin-2-one |
| InChIKey | SOQLLXQXDBRVQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN2C=NC(=O)NC2=C1 |
Computed by PubChem (NCBI)