CAS 1094380-46-7 is the registry number for 3-(5-Chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 1094380-46-7) is a chemical compound with the molecular formula C8H6ClNO3S and a molecular weight of 231.66 g/mol. IUPAC name: 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: QUGVSBHCFWYJOI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 3-(5-chlorothiophen-2-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | QUGVSBHCFWYJOI-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC=C(S2)Cl)C(=O)O |
Computed by PubChem (NCBI)