CAS 199328-31-9 appears in our catalog under these names: 5-Chlorosulfonyloxindole, 95%, 2-Oxoindoline-5-sulfonyl chloride, TECH , 2,3-Dihydro-2-oxo-1H-indole-5-sulphonyl chloride 97%, 2-Oxoindoline-5-sulfonyl chloride, 97%, 97%, 2-Oxo-2,3-dihydro-1H-indole-5-sulfonyl chloride, 95%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250MG, 100mg, 25g, 100g, 2.5g.
2-oxo-1,3-dihydroindole-5-sulfonyl chloride (CAS 199328-31-9) is a chemical compound with the molecular formula C8H6ClNO3S and a molecular weight of 231.66 g/mol. IUPAC name: 2-oxo-1,3-dihydroindole-5-sulfonyl chloride. InChIKey: FYBNVKMJOOYPGI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 2-oxo-1,3-dihydroindole-5-sulfonyl chloride |
| InChIKey | FYBNVKMJOOYPGI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)S(=O)(=O)Cl)NC1=O |
Computed by PubChem (NCBI)