CAS 52206-51-6 is the registry number for 2-Methyl-1,3-benzoxazole-6-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-1,3-benzoxazole-6-sulfonyl chloride (CAS 52206-51-6) is a chemical compound with the molecular formula C8H6ClNO3S and a molecular weight of 231.66 g/mol. IUPAC name: 2-methyl-1,3-benzoxazole-6-sulfonyl chloride. InChIKey: NHBYTQPVOGBVBM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 2-methyl-1,3-benzoxazole-6-sulfonyl chloride |
| InChIKey | NHBYTQPVOGBVBM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)