Products 1261573-04-9
CAS 1261573-04-9 appears in our catalog under these names: 2-Cyano-5-methoxybenzene-1-sulfonyl chloride 97%, 2-Cyano-5-methoxybenzene-1-sulfonyl chloride, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-cyano-5-methoxybenzenesulfonyl chloride (CAS 1261573-04-9) is a chemical compound with the molecular formula C8H6ClNO3S and a molecular weight of 231.66 g/mol. IUPAC name: 2-cyano-5-methoxybenzenesulfonyl chloride. InChIKey: CFOVDTUMIVSQGA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 2-cyano-5-methoxybenzenesulfonyl chloride |
| InChIKey | CFOVDTUMIVSQGA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C#N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)