CAS 1261836-87-6 is the registry number for 2-Cyano-6-methoxybenzenesulfonyl chloride 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
2-cyano-6-methoxybenzenesulfonyl chloride (CAS 1261836-87-6) is a chemical compound with the molecular formula C8H6ClNO3S and a molecular weight of 231.66 g/mol. IUPAC name: 2-cyano-6-methoxybenzenesulfonyl chloride. InChIKey: WDTHAXBDSIHGEP-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3S |
|---|---|
| Molecular weight | 231.66 g/mol |
| IUPAC name | 2-cyano-6-methoxybenzenesulfonyl chloride |
| InChIKey | WDTHAXBDSIHGEP-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)