CAS 1094400-29-9 appears in our catalog under these names: 6-Chloro-7-(chloromethyl)-2,3-dihydro-1,4-benzodioxine, 95%, 6-Chloro-7-(chloromethyl)-2,3-dihydro-1,4-benzodioxine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-chloro-7-(chloromethyl)-2,3-dihydro-1,4-benzodioxine (CAS 1094400-29-9) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 6-chloro-7-(chloromethyl)-2,3-dihydro-1,4-benzodioxine. InChIKey: QZNUTAJVRZNVNQ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 6-chloro-7-(chloromethyl)-2,3-dihydro-1,4-benzodioxine |
| InChIKey | QZNUTAJVRZNVNQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Cl)CCl |
Computed by PubChem (NCBI)