Products 1094453-02-7
CAS 1094453-02-7 is the registry number for 2,3-Dihydro-1,4-benzodioxine-6-sulfonohydrazide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3-dihydro-1,4-benzodioxine-6-sulfonohydrazide (CAS 1094453-02-7) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6-sulfonohydrazide. InChIKey: RCOZJNBLQHDSPI-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-6-sulfonohydrazide |
| InChIKey | RCOZJNBLQHDSPI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)NN |
Computed by PubChem (NCBI)