CAS 1094472-05-5 appears in our catalog under these names: 1-(Dimethyl-1,2-oxazole-4-sulfonamido)cyclopentane-1-carboxylic acid, 95%, 1-(Dimethyl-1,2-oxazole-4-sulfonamido)cyclopentane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]cyclopentane-1-carboxylic acid (CAS 1094472-05-5) is a chemical compound with the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. IUPAC name: 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]cyclopentane-1-carboxylic acid. InChIKey: KTWHCWMXWNQQMX-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O5S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | KTWHCWMXWNQQMX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)S(=O)(=O)NC2(CCCC2)C(=O)O |
Computed by PubChem (NCBI)