Products 1845698-50-1
CAS 1845698-50-1 is the registry number for N-(3-methoxypropyl)-N-(2-nitrophenyl)methanesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(3-methoxypropyl)-N-(2-nitrophenyl)methanesulfonamide (CAS 1845698-50-1) is a chemical compound with the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. IUPAC name: N-(3-methoxypropyl)-N-(2-nitrophenyl)methanesulfonamide. InChIKey: PSABQYAQENCZDC-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O5S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | N-(3-methoxypropyl)-N-(2-nitrophenyl)methanesulfonamide |
| InChIKey | PSABQYAQENCZDC-UHFFFAOYSA-N |
| SMILES | COCCCN(C1=CC=CC=C1[N+](=O)[O-])S(=O)(=O)C |
Computed by PubChem (NCBI)