CAS 349402-18-2 is the registry number for N-(3-Methoxypropyl)-4-methyl-3-nitrobenzenesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
N-(3-methoxypropyl)-4-methyl-3-nitrobenzenesulfonamide (CAS 349402-18-2) is a chemical compound with the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. IUPAC name: N-(3-methoxypropyl)-4-methyl-3-nitrobenzenesulfonamide. InChIKey: DNBUBZRKFYCKPY-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O5S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | N-(3-methoxypropyl)-4-methyl-3-nitrobenzenesulfonamide |
| InChIKey | DNBUBZRKFYCKPY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NCCCOC)[N+](=O)[O-] |
Computed by PubChem (NCBI)