Products 854035-86-2

CAS 854035-86-2 is the registry number for 2-(5-(Diethylsulfamoyl)-2-oxo-1,2-dihydropyridin-1-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetic acid (CAS 854035-86-2) is a chemical compound with the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. IUPAC name: 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetic acid. InChIKey: PAGBNETUTYKLIL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16N2O5S
Molecular weight288.32 g/mol
IUPAC name2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetic acid
InChIKeyPAGBNETUTYKLIL-UHFFFAOYSA-N
SMILESCCN(CC)S(=O)(=O)C1=CN(C(=O)C=C1)CC(=O)O

Computed by PubChem (NCBI)