CAS 854035-86-2 is the registry number for 2-(5-(Diethylsulfamoyl)-2-oxo-1,2-dihydropyridin-1-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetic acid (CAS 854035-86-2) is a chemical compound with the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. IUPAC name: 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetic acid. InChIKey: PAGBNETUTYKLIL-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O5S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]acetic acid |
| InChIKey | PAGBNETUTYKLIL-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CN(C(=O)C=C1)CC(=O)O |
Computed by PubChem (NCBI)