CAS 1242968-55-3 is the registry number for N-(N,N-Dimethylsulfamoyl)-N-(3-methoxyphenyl)glycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[N-(dimethylsulfamoyl)-3-methoxyanilino]acetic acid (CAS 1242968-55-3) is a chemical compound with the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. IUPAC name: 2-[N-(dimethylsulfamoyl)-3-methoxyanilino]acetic acid. InChIKey: ITIPNJJPSBYXCG-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O5S |
|---|---|
| Molecular weight | 288.32 g/mol |
| IUPAC name | 2-[N-(dimethylsulfamoyl)-3-methoxyanilino]acetic acid |
| InChIKey | ITIPNJJPSBYXCG-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)O)C1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)