CAS 1094533-53-5 appears in our catalog under these names: N-(3-Acetylphenyl)-2-bromo-3-methylbutanamide, 95%, N-(3-Acetylphenyl)-2-bromo-3-methylbutanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
N-(3-acetylphenyl)-2-bromo-3-methylbutanamide (CAS 1094533-53-5) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: N-(3-acetylphenyl)-2-bromo-3-methylbutanamide. InChIKey: WGLPUEMSZBMKJZ-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | N-(3-acetylphenyl)-2-bromo-3-methylbutanamide |
| InChIKey | WGLPUEMSZBMKJZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)NC1=CC=CC(=C1)C(=O)C)Br |
Computed by PubChem (NCBI)