Products 1094702-67-6
CAS 1094702-67-6 is the registry number for 5-{8-Oxatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),3,5,10,12-hexaen-4-yloxy}pentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-dibenzofuran-2-yloxypentanoic acid (CAS 1094702-67-6) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 5-dibenzofuran-2-yloxypentanoic acid. InChIKey: AIVZPVAQDZJRQL-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 5-dibenzofuran-2-yloxypentanoic acid |
| InChIKey | AIVZPVAQDZJRQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)OCCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-dibenzofuran-2-yloxypentanoic acid