Products 109492-77-5

CAS 109492-77-5 appears in our catalog under these names: 2–(4–(benzyloxy)phenyl)–2–methylpropanoic acid, 2-(4-(benzyloxy)phenyl)-2-methylpropanoic acid. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-methyl-2-(4-phenylmethoxyphenyl)propanoic acid (CAS 109492-77-5) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 2-methyl-2-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: XLLFTZRAOVWUPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18O3
Molecular weight270.32 g/mol
IUPAC name2-methyl-2-(4-phenylmethoxyphenyl)propanoic acid
InChIKeyXLLFTZRAOVWUPQ-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)