CAS 109492-77-5 appears in our catalog under these names: 2–(4–(benzyloxy)phenyl)–2–methylpropanoic acid, 2-(4-(benzyloxy)phenyl)-2-methylpropanoic acid. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2-methyl-2-(4-phenylmethoxyphenyl)propanoic acid (CAS 109492-77-5) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 2-methyl-2-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: XLLFTZRAOVWUPQ-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 2-methyl-2-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | XLLFTZRAOVWUPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)