Products 109508-83-0
CAS 109508-83-0 is the registry number for 4,7-Dimethoxy-5-(5-methyl-1H-pyrazol-3-yl)benzofuran-6-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
4,7-dimethoxy-5-(5-methyl-1H-pyrazol-3-yl)-1-benzofuran-6-ol (CAS 109508-83-0) is a chemical compound with the molecular formula C14H14N2O4 and a molecular weight of 274.27 g/mol. IUPAC name: 4,7-dimethoxy-5-(5-methyl-1H-pyrazol-3-yl)-1-benzofuran-6-ol. InChIKey: FQVWBZQWMPFNMW-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | 4,7-dimethoxy-5-(5-methyl-1H-pyrazol-3-yl)-1-benzofuran-6-ol |
| InChIKey | FQVWBZQWMPFNMW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)C2=C(C3=C(C(=C2O)OC)OC=C3)OC |
Computed by PubChem (NCBI)