Products 6363-57-1
CAS 6363-57-1 appears in our catalog under these names: Pseudococaine Hydrochloride, >95% (HPLC), Pseudococaine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 25mg.
Methyl (1R,2S,3S,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride (CAS 6363-57-1) is a chemical compound with the molecular formula C17H22ClNO4 and a molecular weight of 339.8 g/mol. IUPAC name: methyl (1R,2S,3S,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride. InChIKey: PIQVDUKEQYOJNR-UOIZBMALSA-N.
| Molecular formula | C17H22ClNO4 |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | methyl (1R,2S,3S,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride |
| InChIKey | PIQVDUKEQYOJNR-UOIZBMALSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@@H]([C@H](C2)OC(=O)C3=CC=CC=C3)C(=O)OC.Cl |
Computed by PubChem (NCBI)