CAS 21030-50-2 is the registry number for rac-Allopseudococaine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
Methyl (1R,2S,3R,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride (CAS 21030-50-2) is a chemical compound with the molecular formula C17H22ClNO4 and a molecular weight of 339.8 g/mol. IUPAC name: methyl (1R,2S,3R,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride. InChIKey: PIQVDUKEQYOJNR-PEVLCXCCSA-N.
| Molecular formula | C17H22ClNO4 |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | methyl (1R,2S,3R,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride |
| InChIKey | PIQVDUKEQYOJNR-PEVLCXCCSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@@H]([C@@H](C2)OC(=O)C3=CC=CC=C3)C(=O)OC.Cl |
Computed by PubChem (NCBI)