Products 131829-34-0
CAS 131829-34-0 is the registry number for (+)-Allopseudococaine Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
Methyl (1S,2R,3S,5R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride (CAS 131829-34-0) is a chemical compound with the molecular formula C17H22ClNO4 and a molecular weight of 339.8 g/mol. IUPAC name: methyl (1S,2R,3S,5R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride. InChIKey: PIQVDUKEQYOJNR-OYEKJGGTSA-N.
| Molecular formula | C17H22ClNO4 |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | methyl (1S,2R,3S,5R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride |
| InChIKey | PIQVDUKEQYOJNR-OYEKJGGTSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1[C@H]([C@H](C2)OC(=O)C3=CC=CC=C3)C(=O)OC.Cl |
Computed by PubChem (NCBI)