Products 1097076-61-3
CAS 1097076-61-3 is the registry number for (4-Chlorophenyl)(3-(difluoromethoxy)phenyl)methanone. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-chlorophenyl)-[3-(difluoromethoxy)phenyl]methanone (CAS 1097076-61-3) is a chemical compound with the molecular formula C14H9ClF2O2 and a molecular weight of 282.67 g/mol. IUPAC name: (4-chlorophenyl)-[3-(difluoromethoxy)phenyl]methanone. InChIKey: NAPIGEFGLKTBJY-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF2O2 |
|---|---|
| Molecular weight | 282.67 g/mol |
| IUPAC name | (4-chlorophenyl)-[3-(difluoromethoxy)phenyl]methanone |
| InChIKey | NAPIGEFGLKTBJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)