CAS 1226857-76-6 is the registry number for 2-(3'-Chloro-[1,1'-biphenyl]-2-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(3-chlorophenyl)phenyl]-2,2-difluoroacetic acid (CAS 1226857-76-6) is a chemical compound with the molecular formula C14H9ClF2O2 and a molecular weight of 282.67 g/mol. IUPAC name: 2-[2-(3-chlorophenyl)phenyl]-2,2-difluoroacetic acid. InChIKey: WXIPAIKNHMZWLV-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF2O2 |
|---|---|
| Molecular weight | 282.67 g/mol |
| IUPAC name | 2-[2-(3-chlorophenyl)phenyl]-2,2-difluoroacetic acid |
| InChIKey | WXIPAIKNHMZWLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)