Products 2764727-98-0
CAS 2764727-98-0 is the registry number for 4-(benzyloxy)-2,6-difluorobenzoyl chloride, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,6-difluoro-4-phenylmethoxybenzoyl chloride (CAS 2764727-98-0) is a chemical compound with the molecular formula C14H9ClF2O2 and a molecular weight of 282.67 g/mol. IUPAC name: 2,6-difluoro-4-phenylmethoxybenzoyl chloride. InChIKey: PLHJGAAPCRHYQN-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF2O2 |
|---|---|
| Molecular weight | 282.67 g/mol |
| IUPAC name | 2,6-difluoro-4-phenylmethoxybenzoyl chloride |
| InChIKey | PLHJGAAPCRHYQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C(=C2)F)C(=O)Cl)F |
Computed by PubChem (NCBI)