CAS 219500-09-1 is the registry number for 2,4-Difluorophenyl 4-(chloromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2,4-difluorophenyl) 4-(chloromethyl)benzoate (CAS 219500-09-1) is a chemical compound with the molecular formula C14H9ClF2O2 and a molecular weight of 282.67 g/mol. IUPAC name: (2,4-difluorophenyl) 4-(chloromethyl)benzoate. InChIKey: LEXMKVWCXKHIBU-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF2O2 |
|---|---|
| Molecular weight | 282.67 g/mol |
| IUPAC name | (2,4-difluorophenyl) 4-(chloromethyl)benzoate |
| InChIKey | LEXMKVWCXKHIBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)C(=O)OC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)