Products 1820705-05-2
CAS 1820705-05-2 is the registry number for methyl 2-chloro-4-(2,4-difluorophenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-chloro-4-(2,4-difluorophenyl)benzoate (CAS 1820705-05-2) is a chemical compound with the molecular formula C14H9ClF2O2 and a molecular weight of 282.67 g/mol. IUPAC name: methyl 2-chloro-4-(2,4-difluorophenyl)benzoate. InChIKey: FUIYKSXIDCGDON-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF2O2 |
|---|---|
| Molecular weight | 282.67 g/mol |
| IUPAC name | methyl 2-chloro-4-(2,4-difluorophenyl)benzoate |
| InChIKey | FUIYKSXIDCGDON-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=C(C=C(C=C2)F)F)Cl |
Computed by PubChem (NCBI)