Products 1097776-71-0
CAS 1097776-71-0 is the registry number for 1-tert-Butyl 3-methyl benzene-1,3-dicarboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-O-tert-butyl 1-O-methyl benzene-1,3-dicarboxylate (CAS 1097776-71-0) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 3-O-tert-butyl 1-O-methyl benzene-1,3-dicarboxylate. InChIKey: JQYPNZGUZGMNHH-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 3-O-tert-butyl 1-O-methyl benzene-1,3-dicarboxylate |
| InChIKey | JQYPNZGUZGMNHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
1-tert-Butyl 3-methyl benzene-1,3-dicarboxylate, tert-Butyl methyl isophthalate, 1,1-dimethylethyl methyl 1,3-benzenedicarboxylate, 3-O-tert-butyl 1-O-methyl benzene-1,3-dicarboxylate, JQYPNZGUZGMNHH-UHFFFAOYSA-N, 1-t-Butyl 3-methyl benZene-1,3-dicarboxylate, O3-tert-butyl O1-methyl benzene-1,3-dicarboxylate, 1-(1,1-Dimethylethyl) 3-methyl 1,3-benzenedicarboxylate