CAS 109787-11-3 appears in our catalog under these names: 4-(trifluoromethyl)benzene-1-sulfonic acid, 97% (hydrate), 97% (hydrate), 4-(Trifluoromethyl)benzenesulfonic acid, 97% (hydrate). Offered by: Chemat, Ambeed. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g.
4-(trifluoromethyl)benzenesulfonic acid (CAS 109787-11-3) is a chemical compound with the molecular formula C7H5F3O3S and a molecular weight of 226.17 g/mol. IUPAC name: 4-(trifluoromethyl)benzenesulfonic acid. InChIKey: RLTPXEAFDJVHSN-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3S |
|---|---|
| Molecular weight | 226.17 g/mol |
| IUPAC name | 4-(trifluoromethyl)benzenesulfonic acid |
| InChIKey | RLTPXEAFDJVHSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)S(=O)(=O)O |
Computed by PubChem (NCBI)