CAS 2137682-45-0 is the registry number for 2,6-Difluoro-4-methoxybenzene-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,6-difluoro-4-methoxybenzenesulfonyl fluoride (CAS 2137682-45-0) is a chemical compound with the molecular formula C7H5F3O3S and a molecular weight of 226.17 g/mol. IUPAC name: 2,6-difluoro-4-methoxybenzenesulfonyl fluoride. InChIKey: IQSJUDPODVNCDT-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3S |
|---|---|
| Molecular weight | 226.17 g/mol |
| IUPAC name | 2,6-difluoro-4-methoxybenzenesulfonyl fluoride |
| InChIKey | IQSJUDPODVNCDT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)S(=O)(=O)F)F |
Computed by PubChem (NCBI)