Products 2137682-45-0

CAS 2137682-45-0 is the registry number for 2,6-Difluoro-4-methoxybenzene-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,6-difluoro-4-methoxybenzenesulfonyl fluoride (CAS 2137682-45-0) is a chemical compound with the molecular formula C7H5F3O3S and a molecular weight of 226.17 g/mol. IUPAC name: 2,6-difluoro-4-methoxybenzenesulfonyl fluoride. InChIKey: IQSJUDPODVNCDT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F3O3S
Molecular weight226.17 g/mol
IUPAC name2,6-difluoro-4-methoxybenzenesulfonyl fluoride
InChIKeyIQSJUDPODVNCDT-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C(=C1)F)S(=O)(=O)F)F

Computed by PubChem (NCBI)