CAS 1197209-25-8 appears in our catalog under these names: Trifluoromethyl benzenesulfonate, 98%, Trifluoromethyl benzenesulfonate, Trifluoromethyl benzenesulfonate 98%, Trifluoromethyl benzenesulfonate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
Trifluoromethyl benzenesulfonate (CAS 1197209-25-8) is a chemical compound with the molecular formula C7H5F3O3S and a molecular weight of 226.17 g/mol. IUPAC name: trifluoromethyl benzenesulfonate. InChIKey: UZPUXLRDLVOKTB-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3S |
|---|---|
| Molecular weight | 226.17 g/mol |
| IUPAC name | trifluoromethyl benzenesulfonate |
| InChIKey | UZPUXLRDLVOKTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OC(F)(F)F |
Computed by PubChem (NCBI)