Products 425426-80-8

CAS 425426-80-8 is the registry number for 3-Methoxy-5-(trifluoromethyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-methoxy-5-(trifluoromethyl)thiophene-2-carboxylic acid (CAS 425426-80-8) is a chemical compound with the molecular formula C7H5F3O3S and a molecular weight of 226.17 g/mol. IUPAC name: 3-methoxy-5-(trifluoromethyl)thiophene-2-carboxylic acid. InChIKey: UDHXNKJSJKISON-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F3O3S
Molecular weight226.17 g/mol
IUPAC name3-methoxy-5-(trifluoromethyl)thiophene-2-carboxylic acid
InChIKeyUDHXNKJSJKISON-UHFFFAOYSA-N
SMILESCOC1=C(SC(=C1)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)