CAS 432-84-8 appears in our catalog under these names: 4-[(Trifluoromethyl)sulphonyl]phenol, 95%, 4-((Trifluoromethyl)sulphonyl)phenol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
4-(trifluoromethylsulfonyl)phenol (CAS 432-84-8) is a chemical compound with the molecular formula C7H5F3O3S and a molecular weight of 226.17 g/mol. IUPAC name: 4-(trifluoromethylsulfonyl)phenol. InChIKey: FGVZAVSVXFMGIK-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O3S |
|---|---|
| Molecular weight | 226.17 g/mol |
| IUPAC name | 4-(trifluoromethylsulfonyl)phenol |
| InChIKey | FGVZAVSVXFMGIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)