CAS 1098-92-6 appears in our catalog under these names: Kaempferol 5,7,4'-trimethyl ether, 3–Hydroxy–5,7,4′–trimethoxyflavone, Kaempferol 5,7,4'-trimethyl ether, 98%, 98%, 3-Hydroxy-5,7,4′-trimethoxyflavone, 98.46%, 3-Hydroxy-5,7,4′-trimethoxyflavone (Standard). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100 mg.
3-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 1098-92-6) is a chemical compound with the molecular formula C18H16O6 and a molecular weight of 328.3 g/mol. IUPAC name: 3-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: SGPXJCVFCJANKN-UHFFFAOYSA-N.
| Molecular formula | C18H16O6 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 3-hydroxy-5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | SGPXJCVFCJANKN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)OC)O |
Computed by PubChem (NCBI)