CAS 109821-96-7 is the registry number for 5-Hydroxy-2,3,4,5-tetrahydro-1-benzothiepine-1,1-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol (CAS 109821-96-7) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: 1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol. InChIKey: FSEYHWQLJZBUCB-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol |
| InChIKey | FSEYHWQLJZBUCB-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2S(=O)(=O)C1)O |
Computed by PubChem (NCBI)