CAS 1423040-77-0 appears in our catalog under these names: (R)-5-Hydroxy-2,3,4,5-tetrahydrobenzo(b)thiepine 1,1-dioxide, 95%, (5R)-5-Hydroxy-2,3,4,5-tetrahydro-1λâ¶-benzothiepine-1,1-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(5R)-1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol (CAS 1423040-77-0) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: (5R)-1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol. InChIKey: FSEYHWQLJZBUCB-SECBINFHSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | (5R)-1,1-dioxo-2,3,4,5-tetrahydro-1lambda6-benzothiepin-5-ol |
| InChIKey | FSEYHWQLJZBUCB-SECBINFHSA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2S(=O)(=O)C1)O |
Computed by PubChem (NCBI)