CAS 1098350-17-4 appears in our catalog under these names: 3-(3,4-Difluorophenyl)propanamide, 95%, 3-(3,4-Difluorophenyl)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(3,4-difluorophenyl)propanamide (CAS 1098350-17-4) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 3-(3,4-difluorophenyl)propanamide. InChIKey: XZQRRQRBAHSJDP-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)propanamide |
| InChIKey | XZQRRQRBAHSJDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC(=O)N)F)F |
Computed by PubChem (NCBI)