CAS 1098352-14-7 appears in our catalog under these names: 1-(2-Fluorophenyl)-3-methyl-2,5-dihydro-1H-pyrrole-2,5-dione, 95%, 1-(2-Fluorophenyl)-3-methyl-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(2-fluorophenyl)-3-methylpyrrole-2,5-dione (CAS 1098352-14-7) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 1-(2-fluorophenyl)-3-methylpyrrole-2,5-dione. InChIKey: SIFBMDYBXHGDNJ-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-3-methylpyrrole-2,5-dione |
| InChIKey | SIFBMDYBXHGDNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C1=O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)