Products 1098366-71-2
CAS 1098366-71-2 appears in our catalog under these names: 4-[(Morpholin-4-ylsulfonyl)methyl]benzoic acid, 98%, 4-((Morpholin-4-ylsulfonyl)methyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
4-(morpholin-4-ylsulfonylmethyl)benzoic acid (CAS 1098366-71-2) is a chemical compound with the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. IUPAC name: 4-(morpholin-4-ylsulfonylmethyl)benzoic acid. InChIKey: WHPPIDUQUUAHQJ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5S |
|---|---|
| Molecular weight | 285.32 g/mol |
| IUPAC name | 4-(morpholin-4-ylsulfonylmethyl)benzoic acid |
| InChIKey | WHPPIDUQUUAHQJ-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)